About [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate
[6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate (PubChem CID 159565860) has the molecular formula C17H24N2O5
and a molecular weight of 336.39 g/mol. Its IUPAC name is [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate.
Molecular Properties
| Compound Name | [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate |
| PubChem CID | 159565860 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate |
| SMILES | COc1cc(C(C)=O)c(OC(C)=O)c(CN2CCNCC2)c1OC |
| InChI | InChI=1S/C17H24N2O5/c1-11(20)13-9-15(22-3)17(23-4)14(16(13)24-12(2)21)10-19-7-5-18-6-8-19/h9,18H,5-8,10H2,1-4H3 |
| InChIKey | JPKRMPJSFQOJIK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate?
The IUPAC name of [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate (CID 159565860) is [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate.
What is the SMILES notation for [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate?
The canonical SMILES for [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate is COc1cc(C(C)=O)c(OC(C)=O)c(CN2CCNCC2)c1OC.
What is the InChIKey of [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate?
The InChIKey is JPKRMPJSFQOJIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O5/c1-11(20)13-9-15(22-3)17(23-4)14(16(13)24-12(2)21)10-19-7-5-18-6-8-19/h9,18H,5-8,10H2,1-4H3.
What are the key properties of [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate?
[6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate has a molecular weight of 336.39 g/mol, XLogP of 1.24, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate is sourced from PubChem (CID 159565860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).