C17H24N2O5 — CID 159565860
[6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate (PubChem CID 159565860) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate.
| Compound Name | [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate |
|---|---|
| PubChem CID | 159565860 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [6-acetyl-3,4-dimethoxy-2-(piperazin-1-ylmethyl)phenyl] acetate |
| SMILES | COc1cc(C(C)=O)c(OC(C)=O)c(CN2CCNCC2)c1OC |
| InChI | InChI=1S/C17H24N2O5/c1-11(20)13-9-15(22-3)17(23-4)14(16(13)24-12(2)21)10-19-7-5-18-6-8-19/h9,18H,5-8,10H2,1-4H3 |
| InChIKey | JPKRMPJSFQOJIK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|