C31H33N9O8 — CID 159567006
tert-butyl 5-aminoindazole-1-carboxylate;tert-butyl 5-nitroindazole-1-carboxylate;5-nitro-1H-indazole (PubChem CID 159567006) has the molecular formula C31H33N9O8 and a molecular weight of 659.66 g/mol. Its IUPAC name is tert-butyl 5-aminoindazole-1-carboxylate;tert-butyl 5-nitroindazole-1-carboxylate;5-nitro-1H-indazole.
| Compound Name | tert-butyl 5-aminoindazole-1-carboxylate;tert-butyl 5-nitroindazole-1-carboxylate;5-nitro-1H-indazole |
|---|---|
| PubChem CID | 159567006 |
| Molecular Formula | C31H33N9O8 |
| Molecular Weight | 659.66 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | tert-butyl 5-aminoindazole-1-carboxylate;tert-butyl 5-nitroindazole-1-carboxylate;5-nitro-1H-indazole |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(N)ccc21.CC(C)(C)OC(=O)n1ncc2cc([N+](=O)[O-])ccc21.O=[N+]([O-])c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C12H13N3O4.C12H15N3O2.C7H5N3O2/c1-12(2,3)19-11(16)14-10-5-4-9(15(17)18)6-8(10)7-13-14;1-12(2,3)17-11(16)15-10-5-4-9(13)6-8(10)7-14-15;11-10(12)6-1-2-7-5(3-6)4-8-9-7/h4-7H,1-3H3;4-7H,13H2,1-3H3;1-4H,(H,8,9) |
| InChIKey | MHIFPAAEBYDJFQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 229.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|