C32H30F5O8S2+ — CID 159580217
1,1,3,3,3-pentafluoro-2-[4-hydroxy-3,5-bis(methoxymethyl)benzoyl]oxypropane-1-sulfonic acid;triphenylsulfanium (PubChem CID 159580217) has the molecular formula C32H30F5O8S2+ and a molecular weight of 701.71 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[4-hydroxy-3,5-bis(methoxymethyl)benzoyl]oxypropane-1-sulfonic acid;triphenylsulfanium.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[4-hydroxy-3,5-bis(methoxymethyl)benzoyl]oxypropane-1-sulfonic acid;triphenylsulfanium |
|---|---|
| PubChem CID | 159580217 |
| Molecular Formula | C32H30F5O8S2+ |
| Molecular Weight | 701.71 g/mol |
| Exact Mass | 701.13 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[4-hydroxy-3,5-bis(methoxymethyl)benzoyl]oxypropane-1-sulfonic acid;triphenylsulfanium |
| SMILES | COCc1cc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)cc(COC)c1O.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H15F5O8S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-25-5-8-3-7(4-9(6-26-2)10(8)20)11(21)27-12(13(15,16)17)14(18,19)28(22,23)24/h1-15H;3-4,12,20H,5-6H2,1-2H3,(H,22,23,24)/q+1; |
| InChIKey | MIXOXVKRPYYMTD-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.71 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|