C21H12F3N3 — CID 159585735
2-[4-(trifluoromethyl)phenyl]-3H-pyrrolo[2,3-f][1,10]phenanthroline (PubChem CID 159585735) has the molecular formula C21H12F3N3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-3H-pyrrolo[2,3-f][1,10]phenanthroline.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-3H-pyrrolo[2,3-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 159585735 |
| Molecular Formula | C21H12F3N3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-3H-pyrrolo[2,3-f][1,10]phenanthroline |
| SMILES | FC(F)(F)c1ccc(C2=Nc3c(c4cccnc4c4ncccc34)C2)cc1 |
| InChI | InChI=1S/C21H12F3N3/c22-21(23,24)13-7-5-12(6-8-13)17-11-16-14-3-1-9-25-19(14)20-15(18(16)27-17)4-2-10-26-20/h1-10H,11H2 |
| InChIKey | UHAISEOYXYBOKY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|