C22H13BrN4 — CID 157451261
2-(5-bromo-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline (PubChem CID 157451261) has the molecular formula C22H13BrN4 and a molecular weight of 413.28 g/mol. Its IUPAC name is 2-(5-bromo-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline.
| Compound Name | 2-(5-bromo-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 157451261 |
| Molecular Formula | C22H13BrN4 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 2-(5-bromo-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline |
| SMILES | Brc1ccc2[nH]cc(C3=Nc4c(c5cccnc5c5ncccc45)C3)c2c1 |
| InChI | InChI=1S/C22H13BrN4/c23-12-5-6-18-15(9-12)17(11-26-18)19-10-16-13-3-1-7-24-21(13)22-14(20(16)27-19)4-2-8-25-22/h1-9,11,26H,10H2 |
| InChIKey | BSVGTKOMIPYYCR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|