C22H20ClN3O2 — CID 15959209
7b-butyl-6-chloro-N-(3-cyanophenyl)-2-oxo-1,3-dihydrocyclopropa[c]quinoline-1a-carboxamide (PubChem CID 15959209) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 7b-butyl-6-chloro-N-(3-cyanophenyl)-2-oxo-1,3-dihydrocyclopropa[c]quinoline-1a-carboxamide.
| Compound Name | 7b-butyl-6-chloro-N-(3-cyanophenyl)-2-oxo-1,3-dihydrocyclopropa[c]quinoline-1a-carboxamide |
|---|---|
| PubChem CID | 15959209 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 7b-butyl-6-chloro-N-(3-cyanophenyl)-2-oxo-1,3-dihydrocyclopropa[c]quinoline-1a-carboxamide |
| SMILES | CCCCC12CC1(C(=O)Nc1cccc(C#N)c1)C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C22H20ClN3O2/c1-2-3-9-21-13-22(21,19(27)25-16-6-4-5-14(10-16)12-24)20(28)26-18-8-7-15(23)11-17(18)21/h4-8,10-11H,2-3,9,13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | FPRZKGJHBUTBSJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|