C28H13N9 — CID 159600386
(2E)-2-[cyano(isocyano)methylidene]-5-[4-(4-cyanophenyl)-6-(4-methylphenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile (PubChem CID 159600386) has the molecular formula C28H13N9 and a molecular weight of 475.48 g/mol. Its IUPAC name is (2E)-2-[cyano(isocyano)methylidene]-5-[4-(4-cyanophenyl)-6-(4-methylphenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile.
| Compound Name | (2E)-2-[cyano(isocyano)methylidene]-5-[4-(4-cyanophenyl)-6-(4-methylphenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 159600386 |
| Molecular Formula | C28H13N9 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (2E)-2-[cyano(isocyano)methylidene]-5-[4-(4-cyanophenyl)-6-(4-methylphenyl)-1,3,5-triazin-2-yl]benzimidazole-4-carbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\N=c2ccc(-c3nc(-c4ccc(C)cc4)nc(-c4ccc(C#N)cc4)n3)c(C#N)c2=N1 |
| InChI | InChI=1S/C28H13N9/c1-16-3-7-18(8-4-16)25-35-26(19-9-5-17(13-29)6-10-19)37-27(36-25)20-11-12-22-24(21(20)14-30)34-28(33-22)23(15-31)32-2/h3-12H,1H3/b28-23+ |
| InChIKey | OXEXNYGZJIRFTF-WEMUOSSPSA-N |
| XLogP | 3.79 |
| TPSA | 139.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|