C21H23F2N2O10S2+ — CID 159602238
2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;methyl 2-fluorosulfonyloxybenzoate;methyl 2-hydroxybenzoate (PubChem CID 159602238) has the molecular formula C21H23F2N2O10S2+ and a molecular weight of 565.55 g/mol. Its IUPAC name is 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;methyl 2-fluorosulfonyloxybenzoate;methyl 2-hydroxybenzoate.
| Compound Name | 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;methyl 2-fluorosulfonyloxybenzoate;methyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 159602238 |
| Molecular Formula | C21H23F2N2O10S2+ |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;methyl 2-fluorosulfonyloxybenzoate;methyl 2-hydroxybenzoate |
| SMILES | COC(=O)c1ccccc1O.COC(=O)c1ccccc1OS(=O)(=O)F.Cc1n(S(=O)(=O)F)cc[n+]1C |
| InChI | InChI=1S/C8H7FO5S.C8H8O3.C5H8FN2O2S/c1-13-8(10)6-4-2-3-5-7(6)14-15(9,11)12;1-11-8(10)6-4-2-3-5-7(6)9;1-5-7(2)3-4-8(5)11(6,9)10/h2-5H,1H3;2-5,9H,1H3;3-4H,1-2H3/q;;+1 |
| InChIKey | MLPYQZICOUJLKR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 159.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|