C18H40NO7S- — CID 159608415
2-(diethylamino)ethanol;2-[2-(2-ethylhexoxy)ethoxy]ethyl sulfate (PubChem CID 159608415) has the molecular formula C18H40NO7S- and a molecular weight of 414.59 g/mol. Its IUPAC name is 2-(diethylamino)ethanol;2-[2-(2-ethylhexoxy)ethoxy]ethyl sulfate.
| Compound Name | 2-(diethylamino)ethanol;2-[2-(2-ethylhexoxy)ethoxy]ethyl sulfate |
|---|---|
| PubChem CID | 159608415 |
| Molecular Formula | C18H40NO7S- |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-(diethylamino)ethanol;2-[2-(2-ethylhexoxy)ethoxy]ethyl sulfate |
| SMILES | CCCCC(CC)COCCOCCOS(=O)(=O)[O-].CCN(CC)CCO |
| InChI | InChI=1S/C12H26O6S.C6H15NO/c1-3-5-6-12(4-2)11-17-8-7-16-9-10-18-19(13,14)15;1-3-7(4-2)5-6-8/h12H,3-11H2,1-2H3,(H,13,14,15);8H,3-6H2,1-2H3/p-1 |
| InChIKey | MMJGMUMTCWFIBD-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|