About 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol
1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol (PubChem CID 159618122) has the molecular formula C14H30N2O2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol.
Molecular Properties
| Compound Name | 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol |
| PubChem CID | 159618122 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol |
| SMILES | CN1CCCC(O)C1.COCN1CCCCC1C |
| InChI | InChI=1S/C8H17NO.C6H13NO/c1-8-5-3-4-6-9(8)7-10-2;1-7-4-2-3-6(8)5-7/h8H,3-7H2,1-2H3;6,8H,2-5H2,1H3 |
| InChIKey | MNNUOVTYZCAZLB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol?
The IUPAC name of 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol (CID 159618122) is 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol.
What is the SMILES notation for 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol?
The canonical SMILES for 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol is CN1CCCC(O)C1.COCN1CCCCC1C.
What is the InChIKey of 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol?
The InChIKey is MNNUOVTYZCAZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C6H13NO/c1-8-5-3-4-6-9(8)7-10-2;1-7-4-2-3-6(8)5-7/h8H,3-7H2,1-2H3;6,8H,2-5H2,1H3.
What are the key properties of 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol?
1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol has a molecular weight of 258.41 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethyl)-2-methylpiperidine;1-methylpiperidin-3-ol is sourced from PubChem (CID 159618122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).