C34H38N8O4 — CID 159621292
5-[4-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperazin-1-yl]-N-(oxan-2-yloxy)-5-oxopentanamide (PubChem CID 159621292) has the molecular formula C34H38N8O4 and a molecular weight of 622.73 g/mol. Its IUPAC name is 5-[4-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperazin-1-yl]-N-(oxan-2-yloxy)-5-oxopentanamide.
| Compound Name | 5-[4-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperazin-1-yl]-N-(oxan-2-yloxy)-5-oxopentanamide |
|---|---|
| PubChem CID | 159621292 |
| Molecular Formula | C34H38N8O4 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 5-[4-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperazin-1-yl]-N-(oxan-2-yloxy)-5-oxopentanamide |
| SMILES | O=C(CCCC(=O)N1CCN(c2ccc(Nc3nc(-c4ccc5c(c4)CN=C5)cn4ccnc34)cc2)CC1)NOC1CCCCO1 |
| InChI | InChI=1S/C34H38N8O4/c43-30(39-46-32-6-1-2-19-45-32)4-3-5-31(44)41-17-15-40(16-18-41)28-11-9-27(10-12-28)37-33-34-36-13-14-42(34)23-29(38-33)24-7-8-25-21-35-22-26(25)20-24/h7-14,20-21,23,32H,1-6,15-19,22H2,(H,37,38)(H,39,43) |
| InChIKey | FZYYTRPLAHNTGV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|