C34H54N2O3Si — CID 159622637
1-(1-benzyl-4-ethylpyrrolidin-3-yl)ethanone;hex-3-en-2-one;N-(methoxymethyl)-1-phenyl-N-(trimethylsilylmethyl)methanamine (PubChem CID 159622637) has the molecular formula C34H54N2O3Si and a molecular weight of 566.90 g/mol. Its IUPAC name is 1-(1-benzyl-4-ethylpyrrolidin-3-yl)ethanone;hex-3-en-2-one;N-(methoxymethyl)-1-phenyl-N-(trimethylsilylmethyl)methanamine.
| Compound Name | 1-(1-benzyl-4-ethylpyrrolidin-3-yl)ethanone;hex-3-en-2-one;N-(methoxymethyl)-1-phenyl-N-(trimethylsilylmethyl)methanamine |
|---|---|
| PubChem CID | 159622637 |
| Molecular Formula | C34H54N2O3Si |
| Molecular Weight | 566.90 g/mol |
| Exact Mass | 566.39 |
| IUPAC Name | 1-(1-benzyl-4-ethylpyrrolidin-3-yl)ethanone;hex-3-en-2-one;N-(methoxymethyl)-1-phenyl-N-(trimethylsilylmethyl)methanamine |
| SMILES | CCC1CN(Cc2ccccc2)CC1C(C)=O.CCC=CC(C)=O.COCN(Cc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C15H21NO.C13H23NOSi.C6H10O/c1-3-14-10-16(11-15(14)12(2)17)9-13-7-5-4-6-8-13;1-15-11-14(12-16(2,3)4)10-13-8-6-5-7-9-13;1-3-4-5-6(2)7/h4-8,14-15H,3,9-11H2,1-2H3;5-9H,10-12H2,1-4H3;4-5H,3H2,1-2H3 |
| InChIKey | MOBUVWAPUOXWNN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.90 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|