C20H34O7S — CID 159649106
2,2-diethoxyethyl [2-(6-methylheptyl)phenoxy] sulfate (PubChem CID 159649106) has the molecular formula C20H34O7S and a molecular weight of 418.55 g/mol. Its IUPAC name is 2,2-diethoxyethyl [2-(6-methylheptyl)phenoxy] sulfate.
| Compound Name | 2,2-diethoxyethyl [2-(6-methylheptyl)phenoxy] sulfate |
|---|---|
| PubChem CID | 159649106 |
| Molecular Formula | C20H34O7S |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2,2-diethoxyethyl [2-(6-methylheptyl)phenoxy] sulfate |
| SMILES | CCOC(COS(=O)(=O)OOc1ccccc1CCCCCC(C)C)OCC |
| InChI | InChI=1S/C20H34O7S/c1-5-23-20(24-6-2)16-25-28(21,22)27-26-19-15-11-10-14-18(19)13-9-7-8-12-17(3)4/h10-11,14-15,17,20H,5-9,12-13,16H2,1-4H3 |
| InChIKey | MRILCXWJOJSABZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|