C22H40BrO2P — CID 156693221
bromo-[2-(9,9-diethoxynonyl)phenyl]-trimethyl-λ5-phosphane (PubChem CID 156693221) has the molecular formula C22H40BrO2P and a molecular weight of 447.44 g/mol. Its IUPAC name is bromo-[2-(9,9-diethoxynonyl)phenyl]-trimethyl-λ5-phosphane.
| Compound Name | bromo-[2-(9,9-diethoxynonyl)phenyl]-trimethyl-λ5-phosphane |
|---|---|
| PubChem CID | 156693221 |
| Molecular Formula | C22H40BrO2P |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | bromo-[2-(9,9-diethoxynonyl)phenyl]-trimethyl-λ5-phosphane |
| SMILES | CCOC(CCCCCCCCc1ccccc1P(C)(C)(C)Br)OCC |
| InChI | InChI=1S/C22H40BrO2P/c1-6-24-22(25-7-2)19-13-11-9-8-10-12-16-20-17-14-15-18-21(20)26(3,4,5)23/h14-15,17-18,22H,6-13,16,19H2,1-5H3 |
| InChIKey | BKIFYSGYMFIWDQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|