C23H42N2O4 — CID 159651494
N-(4,4-dimethyl-2-oxononan-3-yl)formamide;N-(4-methyl-2-oxonon-3-en-3-yl)formamide (PubChem CID 159651494) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is N-(4,4-dimethyl-2-oxononan-3-yl)formamide;N-(4-methyl-2-oxonon-3-en-3-yl)formamide.
| Compound Name | N-(4,4-dimethyl-2-oxononan-3-yl)formamide;N-(4-methyl-2-oxonon-3-en-3-yl)formamide |
|---|---|
| PubChem CID | 159651494 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | N-(4,4-dimethyl-2-oxononan-3-yl)formamide;N-(4-methyl-2-oxonon-3-en-3-yl)formamide |
| SMILES | CCCCCC(C)(C)C(NC=O)C(C)=O.CCCCCC(C)=C(NC=O)C(C)=O |
| InChI | InChI=1S/C12H23NO2.C11H19NO2/c1-5-6-7-8-12(3,4)11(10(2)15)13-9-14;1-4-5-6-7-9(2)11(10(3)14)12-8-13/h9,11H,5-8H2,1-4H3,(H,13,14);8H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | MRPXTTHOXYCBCX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|