C30H53NO10 — CID 159653214
(4R)-8,8-dimethyl-3,7-dioxo-4-[4-[3-[2-[2-[2-(4-oxohexoxy)ethoxy]ethoxy]ethoxy]propanoylamino]butyl]nonanoic acid (PubChem CID 159653214) has the molecular formula C30H53NO10 and a molecular weight of 587.75 g/mol. Its IUPAC name is (4R)-8,8-dimethyl-3,7-dioxo-4-[4-[3-[2-[2-[2-(4-oxohexoxy)ethoxy]ethoxy]ethoxy]propanoylamino]butyl]nonanoic acid.
| Compound Name | (4R)-8,8-dimethyl-3,7-dioxo-4-[4-[3-[2-[2-[2-(4-oxohexoxy)ethoxy]ethoxy]ethoxy]propanoylamino]butyl]nonanoic acid |
|---|---|
| PubChem CID | 159653214 |
| Molecular Formula | C30H53NO10 |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.37 |
| IUPAC Name | (4R)-8,8-dimethyl-3,7-dioxo-4-[4-[3-[2-[2-[2-(4-oxohexoxy)ethoxy]ethoxy]ethoxy]propanoylamino]butyl]nonanoic acid |
| SMILES | CCC(=O)CCCOCCOCCOCCOCCC(=O)NCCCC[C@H](CCC(=O)C(C)(C)C)C(=O)CC(=O)O |
| InChI | InChI=1S/C30H53NO10/c1-5-25(32)10-8-15-38-17-19-40-21-22-41-20-18-39-16-13-28(35)31-14-7-6-9-24(26(33)23-29(36)37)11-12-27(34)30(2,3)4/h24H,5-23H2,1-4H3,(H,31,35)(H,36,37)/t24-/m1/s1 |
| InChIKey | CIYKNVAUZWRDAB-XMMPIXPASA-N |
| XLogP | 3.54 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|