C24H24O — CID 159655947
5-naphthalen-1-ylhex-1-yn-3-one;1,3-xylene (PubChem CID 159655947) has the molecular formula C24H24O and a molecular weight of 328.46 g/mol. Its IUPAC name is 5-naphthalen-1-ylhex-1-yn-3-one;1,3-xylene.
| Compound Name | 5-naphthalen-1-ylhex-1-yn-3-one;1,3-xylene |
|---|---|
| PubChem CID | 159655947 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 5-naphthalen-1-ylhex-1-yn-3-one;1,3-xylene |
| SMILES | C#CC(=O)CC(C)c1cccc2ccccc12.Cc1cccc(C)c1 |
| InChI | InChI=1S/C16H14O.C8H10/c1-3-14(17)11-12(2)15-10-6-8-13-7-4-5-9-16(13)15;1-7-4-3-5-8(2)6-7/h1,4-10,12H,11H2,2H3;3-6H,1-2H3 |
| InChIKey | MSEGNHXRZXNCPI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|