C45H39NO2 — CID 157168700
1-ethynyl-3-methylbenzene;1-[(1R)-1-isocyanatoethyl]naphthalene;(5S)-1-(3-methylphenyl)-5-naphthalen-1-ylhex-1-yn-3-one (PubChem CID 157168700) has the molecular formula C45H39NO2 and a molecular weight of 625.81 g/mol. Its IUPAC name is 1-ethynyl-3-methylbenzene;1-[(1R)-1-isocyanatoethyl]naphthalene;(5S)-1-(3-methylphenyl)-5-naphthalen-1-ylhex-1-yn-3-one.
| Compound Name | 1-ethynyl-3-methylbenzene;1-[(1R)-1-isocyanatoethyl]naphthalene;(5S)-1-(3-methylphenyl)-5-naphthalen-1-ylhex-1-yn-3-one |
|---|---|
| PubChem CID | 157168700 |
| Molecular Formula | C45H39NO2 |
| Molecular Weight | 625.81 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | 1-ethynyl-3-methylbenzene;1-[(1R)-1-isocyanatoethyl]naphthalene;(5S)-1-(3-methylphenyl)-5-naphthalen-1-ylhex-1-yn-3-one |
| SMILES | C#Cc1cccc(C)c1.C[C@@H](N=C=O)c1cccc2ccccc12.Cc1cccc(C#CC(=O)C[C@H](C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C23H20O.C13H11NO.C9H8/c1-17-7-5-8-19(15-17)13-14-21(24)16-18(2)22-12-6-10-20-9-3-4-11-23(20)22;1-10(14-9-15)12-8-4-6-11-5-2-3-7-13(11)12;1-3-9-6-4-5-8(2)7-9/h3-12,15,18H,16H2,1-2H3;2-8,10H,1H3;1,4-7H,2H3/t18-;10-;/m01./s1 |
| InChIKey | ANFCDMAMHBWLGM-GSHFVJMOSA-N |
| XLogP | 10.48 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.81 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|