C20H18O4 — CID 159548668
(3R)-3-naphthalen-1-yl-1-(3,4,5-trihydroxyphenyl)butan-1-one (PubChem CID 159548668) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is (3R)-3-naphthalen-1-yl-1-(3,4,5-trihydroxyphenyl)butan-1-one.
| Compound Name | (3R)-3-naphthalen-1-yl-1-(3,4,5-trihydroxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 159548668 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (3R)-3-naphthalen-1-yl-1-(3,4,5-trihydroxyphenyl)butan-1-one |
| SMILES | C[C@H](CC(=O)c1cc(O)c(O)c(O)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18O4/c1-12(15-8-4-6-13-5-2-3-7-16(13)15)9-17(21)14-10-18(22)20(24)19(23)11-14/h2-8,10-12,22-24H,9H2,1H3/t12-/m1/s1 |
| InChIKey | MFCQELLWFNXMOU-GFCCVEGCSA-N |
| XLogP | 4.33 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|