C41H33F3O6S — CID 159657807
2-(trifluoromethyl)benzenesulfonic acid;1,2,3-tris(4-methoxyphenyl)-9H-fluorene (PubChem CID 159657807) has the molecular formula C41H33F3O6S and a molecular weight of 710.77 g/mol. Its IUPAC name is 2-(trifluoromethyl)benzenesulfonic acid;1,2,3-tris(4-methoxyphenyl)-9H-fluorene.
| Compound Name | 2-(trifluoromethyl)benzenesulfonic acid;1,2,3-tris(4-methoxyphenyl)-9H-fluorene |
|---|---|
| PubChem CID | 159657807 |
| Molecular Formula | C41H33F3O6S |
| Molecular Weight | 710.77 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | 2-(trifluoromethyl)benzenesulfonic acid;1,2,3-tris(4-methoxyphenyl)-9H-fluorene |
| SMILES | COc1ccc(-c2cc3c(c(-c4ccc(OC)cc4)c2-c2ccc(OC)cc2)Cc2ccccc2-3)cc1.O=S(=O)(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C34H28O3.C7H5F3O3S/c1-35-26-14-8-22(9-15-26)30-21-31-29-7-5-4-6-25(29)20-32(31)34(24-12-18-28(37-3)19-13-24)33(30)23-10-16-27(36-2)17-11-23;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h4-19,21H,20H2,1-3H3;1-4H,(H,11,12,13) |
| InChIKey | MSKBTHACXJTPHX-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.77 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|