C12H15Al — CID 159666382
di(cyclopenta-2,4-dien-1-yl)-ethylalumane (PubChem CID 159666382) has the molecular formula C12H15Al and a molecular weight of 186.23 g/mol. Its IUPAC name is di(cyclopenta-2,4-dien-1-yl)-ethylalumane.
| Compound Name | di(cyclopenta-2,4-dien-1-yl)-ethylalumane |
|---|---|
| PubChem CID | 159666382 |
| Molecular Formula | C12H15Al |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | di(cyclopenta-2,4-dien-1-yl)-ethylalumane |
| SMILES | CC[Al](C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/2C5H5.C2H5.Al/c2*1-2-4-5-3-1;1-2;/h2*1-5H;1H2,2H3; |
| InChIKey | MTLMHOMERKDUEX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |