C18H20O4 — CID 159676212
1-ethyl-3-(3-methoxyphenyl)-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 159676212) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-ethyl-3-(3-methoxyphenyl)-3,4-dihydro-1H-isochromene-5,6-diol.
| Compound Name | 1-ethyl-3-(3-methoxyphenyl)-3,4-dihydro-1H-isochromene-5,6-diol |
|---|---|
| PubChem CID | 159676212 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-ethyl-3-(3-methoxyphenyl)-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | CCC1OC(c2cccc(OC)c2)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C18H20O4/c1-3-16-13-7-8-15(19)18(20)14(13)10-17(22-16)11-5-4-6-12(9-11)21-2/h4-9,16-17,19-20H,3,10H2,1-2H3 |
| InChIKey | UEVJVVSTLQGDIJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|