C15H27N2O4S+ — CID 159676695
3-butyl-1H-imidazol-3-ium;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid (PubChem CID 159676695) has the molecular formula C15H27N2O4S+ and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-butyl-1H-imidazol-3-ium;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid.
| Compound Name | 3-butyl-1H-imidazol-3-ium;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 159676695 |
| Molecular Formula | C15H27N2O4S+ |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3-butyl-1H-imidazol-3-ium;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid |
| SMILES | C=CC(=O)CC(C)(C)CS(=O)(=O)O.CCCC[n+]1cc[nH]c1 |
| InChI | InChI=1S/C8H14O4S.C7H12N2/c1-4-7(9)5-8(2,3)6-13(10,11)12;1-2-3-5-9-6-4-8-7-9/h4H,1,5-6H2,2-3H3,(H,10,11,12);4,6-7H,2-3,5H2,1H3/p+1 |
| InChIKey | DVWARCUULMKVKA-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 91.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|