C16H28N2O4S — CID 161462537
1-butyl-3-methyl-4H-imidazol-3-ium-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid (PubChem CID 161462537) has the molecular formula C16H28N2O4S and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-butyl-3-methyl-4H-imidazol-3-ium-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid.
| Compound Name | 1-butyl-3-methyl-4H-imidazol-3-ium-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 161462537 |
| Molecular Formula | C16H28N2O4S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-butyl-3-methyl-4H-imidazol-3-ium-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid |
| SMILES | C=CC(=O)CC(C)(C)CS(=O)(=O)O.CCCCn1c[c-][n+](C)c1 |
| InChI | InChI=1S/C8H14N2.C8H14O4S/c1-3-4-5-10-7-6-9(2)8-10;1-4-7(9)5-8(2,3)6-13(10,11)12/h7-8H,3-5H2,1-2H3;4H,1,5-6H2,2-3H3,(H,10,11,12) |
| InChIKey | FWMPMIPAQDHSOD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|