C15H25N2O4S- — CID 158934109
1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid (PubChem CID 158934109) has the molecular formula C15H25N2O4S- and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid.
| Compound Name | 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 158934109 |
| Molecular Formula | C15H25N2O4S- |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid |
| SMILES | C=CC(=O)CC(C)(C)CS(=O)(=O)O.CCCCn1c[c-]nc1 |
| InChI | InChI=1S/C8H14O4S.C7H11N2/c1-4-7(9)5-8(2,3)6-13(10,11)12;1-2-3-5-9-6-4-8-7-9/h4H,1,5-6H2,2-3H3,(H,10,11,12);6-7H,2-3,5H2,1H3/q;-1 |
| InChIKey | JJKYBMSEEIPLOR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|