About 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid
1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid (PubChem CID 158934109) has the molecular formula C15H25N2O4S-
and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid.
Molecular Properties
| Compound Name | 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid |
| PubChem CID | 158934109 |
| Molecular Formula | C15H25N2O4S- |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid |
| SMILES | C=CC(=O)CC(C)(C)CS(=O)(=O)O.CCCCn1c[c-]nc1 |
| InChI | InChI=1S/C8H14O4S.C7H11N2/c1-4-7(9)5-8(2,3)6-13(10,11)12;1-2-3-5-9-6-4-8-7-9/h4H,1,5-6H2,2-3H3,(H,10,11,12);6-7H,2-3,5H2,1H3/q;-1 |
| InChIKey | JJKYBMSEEIPLOR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid?
The IUPAC name of 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid (CID 158934109) is 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid.
What is the SMILES notation for 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid?
The canonical SMILES for 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid is C=CC(=O)CC(C)(C)CS(=O)(=O)O.CCCCn1c[c-]nc1.
What is the InChIKey of 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid?
The InChIKey is JJKYBMSEEIPLOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4S.C7H11N2/c1-4-7(9)5-8(2,3)6-13(10,11)12;1-2-3-5-9-6-4-8-7-9/h4H,1,5-6H2,2-3H3,(H,10,11,12);6-7H,2-3,5H2,1H3/q;-1.
What are the key properties of 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid?
1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid has a molecular weight of 329.44 g/mol, XLogP of 2.53, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4H-imidazol-4-ide;2,2-dimethyl-4-oxohex-5-ene-1-sulfonic acid is sourced from PubChem (CID 158934109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).