C9H18O6S — CID 159679579
3-hydroxypropyl prop-2-enoate;propane-1-sulfonic acid (PubChem CID 159679579) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is 3-hydroxypropyl prop-2-enoate;propane-1-sulfonic acid.
| Compound Name | 3-hydroxypropyl prop-2-enoate;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 159679579 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-hydroxypropyl prop-2-enoate;propane-1-sulfonic acid |
| SMILES | C=CC(=O)OCCCO.CCCS(=O)(=O)O |
| InChI | InChI=1S/C6H10O3.C3H8O3S/c1-2-6(8)9-5-3-4-7;1-2-3-7(4,5)6/h2,7H,1,3-5H2;2-3H2,1H3,(H,4,5,6) |
| InChIKey | MVAUXMHUHKSFRD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|