C21H39ISi3 — CID 159694576
[(E)-4-iodo-3-methylpent-3-en-1-ynyl]-trimethylsilane;trimethyl-[(E)-3-methyl-4-trimethylsilylpent-3-en-1-ynyl]silane (PubChem CID 159694576) has the molecular formula C21H39ISi3 and a molecular weight of 502.71 g/mol. Its IUPAC name is [(E)-4-iodo-3-methylpent-3-en-1-ynyl]-trimethylsilane;trimethyl-[(E)-3-methyl-4-trimethylsilylpent-3-en-1-ynyl]silane.
| Compound Name | [(E)-4-iodo-3-methylpent-3-en-1-ynyl]-trimethylsilane;trimethyl-[(E)-3-methyl-4-trimethylsilylpent-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 159694576 |
| Molecular Formula | C21H39ISi3 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | [(E)-4-iodo-3-methylpent-3-en-1-ynyl]-trimethylsilane;trimethyl-[(E)-3-methyl-4-trimethylsilylpent-3-en-1-ynyl]silane |
| SMILES | C/C(C#C[Si](C)(C)C)=C(/C)[Si](C)(C)C.C/C(I)=C(/C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H24Si2.C9H15ISi/c1-11(9-10-13(3,4)5)12(2)14(6,7)8;1-8(9(2)10)6-7-11(3,4)5/h1-8H3;1-5H3/b12-11+;9-8+ |
| InChIKey | MWVPVZURNWFDDV-PYVAALJUSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|