C36H25ClN10O3S2 — CID 159697692
3-(chloromethyl)-6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole;N-[2-[3-(imidazol-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]quinoxaline-2-carboxamide (PubChem CID 159697692) has the molecular formula C36H25ClN10O3S2 and a molecular weight of 745.25 g/mol. Its IUPAC name is 3-(chloromethyl)-6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole;N-[2-[3-(imidazol-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]quinoxaline-2-carboxamide.
| Compound Name | 3-(chloromethyl)-6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole;N-[2-[3-(imidazol-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 159697692 |
| Molecular Formula | C36H25ClN10O3S2 |
| Molecular Weight | 745.25 g/mol |
| Exact Mass | 744.12 |
| IUPAC Name | 3-(chloromethyl)-6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazole;N-[2-[3-(imidazol-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]quinoxaline-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1cn2c(Cn3ccnc3)csc2n1)c1cnc2ccccc2n1.O=[N+]([O-])c1ccccc1-c1cn2c(CCl)csc2n1 |
| InChI | InChI=1S/C24H17N7OS.C12H8ClN3O2S/c32-23(21-11-26-19-7-3-4-8-20(19)27-21)28-18-6-2-1-5-17(18)22-13-31-16(14-33-24(31)29-22)12-30-10-9-25-15-30;13-5-8-7-19-12-14-10(6-15(8)12)9-3-1-2-4-11(9)16(17)18/h1-11,13-15H,12H2,(H,28,32);1-4,6-7H,5H2 |
| InChIKey | MXFMHVCOXWSXOX-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 150.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.25 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|