C12H22N2O2 — CID 15970102
1,2-di(piperidin-1-yl)ethene-1,2-diol (PubChem CID 15970102) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1,2-di(piperidin-1-yl)ethene-1,2-diol.
| Compound Name | 1,2-di(piperidin-1-yl)ethene-1,2-diol |
|---|---|
| PubChem CID | 15970102 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1,2-di(piperidin-1-yl)ethene-1,2-diol |
| SMILES | OC(=C(O)N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C12H22N2O2/c15-11(13-7-3-1-4-8-13)12(16)14-9-5-2-6-10-14/h15-16H,1-10H2 |
| InChIKey | IBCKHOCUHLRNGW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|