C11H10N4O2 — CID 164763675
(3Z)-2,4-dihydroxy-4-pyrrolidin-1-ylbuta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 164763675) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is (3Z)-2,4-dihydroxy-4-pyrrolidin-1-ylbuta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3Z)-2,4-dihydroxy-4-pyrrolidin-1-ylbuta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 164763675 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (3Z)-2,4-dihydroxy-4-pyrrolidin-1-ylbuta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C(O)/C(C#N)=C(\O)N1CCCC1 |
| InChI | InChI=1S/C11H10N4O2/c12-5-8(6-13)10(16)9(7-14)11(17)15-3-1-2-4-15/h16-17H,1-4H2/b11-9- |
| InChIKey | JSNXLDLSVKSXIR-LUAWRHEFSA-N |
| XLogP | 1.23 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|