C6H20O12P4 — CID 159702232
[hydroxy(phosphonooxy)phosphoryl]oxy-propan-2-ylphosphinic acid;propan-2-ylphosphonic acid (PubChem CID 159702232) has the molecular formula C6H20O12P4 and a molecular weight of 408.11 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl]oxy-propan-2-ylphosphinic acid;propan-2-ylphosphonic acid.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl]oxy-propan-2-ylphosphinic acid;propan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 159702232 |
| Molecular Formula | C6H20O12P4 |
| Molecular Weight | 408.11 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl]oxy-propan-2-ylphosphinic acid;propan-2-ylphosphonic acid |
| SMILES | CC(C)P(=O)(O)O.CC(C)P(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C3H11O9P3.C3H9O3P/c1-3(2)13(4,5)11-15(9,10)12-14(6,7)8;1-3(2)7(4,5)6/h3H,1-2H3,(H,4,5)(H,9,10)(H2,6,7,8);3H,1-2H3,(H2,4,5,6) |
| InChIKey | MXTQLZYZGSDMTK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.11 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|