C38H41F4NO7 — CID 159705753
benzyl (E)-4-cyclobutyl-4,4-difluorobut-2-enoate;benzyl 4-cyclobutyl-4,4-difluoro-2-hydroxy-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 159705753) has the molecular formula C38H41F4NO7 and a molecular weight of 699.74 g/mol. Its IUPAC name is benzyl (E)-4-cyclobutyl-4,4-difluorobut-2-enoate;benzyl 4-cyclobutyl-4,4-difluoro-2-hydroxy-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | benzyl (E)-4-cyclobutyl-4,4-difluorobut-2-enoate;benzyl 4-cyclobutyl-4,4-difluoro-2-hydroxy-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 159705753 |
| Molecular Formula | C38H41F4NO7 |
| Molecular Weight | 699.74 g/mol |
| Exact Mass | 699.28 |
| IUPAC Name | benzyl (E)-4-cyclobutyl-4,4-difluorobut-2-enoate;benzyl 4-cyclobutyl-4,4-difluoro-2-hydroxy-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | O=C(/C=C/C(F)(F)C1CCC1)OCc1ccccc1.O=C(NC(C(O)C(=O)OCc1ccccc1)C(F)(F)C1CCC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H25F2NO5.C15H16F2O2/c24-23(25,18-12-7-13-18)20(26-22(29)31-15-17-10-5-2-6-11-17)19(27)21(28)30-14-16-8-3-1-4-9-16;16-15(17,13-7-4-8-13)10-9-14(18)19-11-12-5-2-1-3-6-12/h1-6,8-11,18-20,27H,7,12-15H2,(H,26,29);1-3,5-6,9-10,13H,4,7-8,11H2/b;10-9+ |
| InChIKey | MYELLCAJKYUCIL-GMOHPMBGSA-N |
| XLogP | 7.54 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.74 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|