C22H32N2O3S2 — CID 159708212
ethyl acetate;2-phenylsulfanylethanamine;N-(2-phenylsulfanylethyl)acetamide (PubChem CID 159708212) has the molecular formula C22H32N2O3S2 and a molecular weight of 436.64 g/mol. Its IUPAC name is ethyl acetate;2-phenylsulfanylethanamine;N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | ethyl acetate;2-phenylsulfanylethanamine;N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 159708212 |
| Molecular Formula | C22H32N2O3S2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | ethyl acetate;2-phenylsulfanylethanamine;N-(2-phenylsulfanylethyl)acetamide |
| SMILES | CC(=O)NCCSc1ccccc1.CCOC(C)=O.NCCSc1ccccc1 |
| InChI | InChI=1S/C10H13NOS.C8H11NS.C4H8O2/c1-9(12)11-7-8-13-10-5-3-2-4-6-10;9-6-7-10-8-4-2-1-3-5-8;1-3-6-4(2)5/h2-6H,7-8H2,1H3,(H,11,12);1-5H,6-7,9H2;3H2,1-2H3 |
| InChIKey | MYMLXQUBRYWBNN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|