C16H19N5 — CID 159709747
4-N-butyl-7-pyrazol-1-ylquinoline-2,4-diamine (PubChem CID 159709747) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-N-butyl-7-pyrazol-1-ylquinoline-2,4-diamine.
| Compound Name | 4-N-butyl-7-pyrazol-1-ylquinoline-2,4-diamine |
|---|---|
| PubChem CID | 159709747 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-N-butyl-7-pyrazol-1-ylquinoline-2,4-diamine |
| SMILES | CCCCNc1cc(N)nc2cc(-n3cccn3)ccc12 |
| InChI | InChI=1S/C16H19N5/c1-2-3-7-18-14-11-16(17)20-15-10-12(5-6-13(14)15)21-9-4-8-19-21/h4-6,8-11H,2-3,7H2,1H3,(H3,17,18,20) |
| InChIKey | ZYSRCAASIZOOKT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|