C16H18N6O — CID 170385422
3-[(2-amino-3-methanimidoyl-7-pyrazol-1-ylquinolin-4-yl)amino]propan-1-ol (PubChem CID 170385422) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 3-[(2-amino-3-methanimidoyl-7-pyrazol-1-ylquinolin-4-yl)amino]propan-1-ol.
| Compound Name | 3-[(2-amino-3-methanimidoyl-7-pyrazol-1-ylquinolin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 170385422 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-[(2-amino-3-methanimidoyl-7-pyrazol-1-ylquinolin-4-yl)amino]propan-1-ol |
| SMILES | [H]/N=C/c1c(N)nc2cc(-n3cccn3)ccc2c1NCCCO |
| InChI | InChI=1S/C16H18N6O/c17-10-13-15(19-5-2-8-23)12-4-3-11(22-7-1-6-20-22)9-14(12)21-16(13)18/h1,3-4,6-7,9-10,17,23H,2,5,8H2,(H3,18,19,21)/b17-10+ |
| InChIKey | DBOKWNDEMVIYNF-LICLKQGHSA-N |
| XLogP | 1.79 |
| TPSA | 112.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|