C15H17N5O — CID 163624490
3-[(2-cyclopenta-1,3-dien-1-yl-6-pyrazol-1-ylpyrimidin-4-yl)amino]propan-1-ol (PubChem CID 163624490) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[(2-cyclopenta-1,3-dien-1-yl-6-pyrazol-1-ylpyrimidin-4-yl)amino]propan-1-ol.
| Compound Name | 3-[(2-cyclopenta-1,3-dien-1-yl-6-pyrazol-1-ylpyrimidin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 163624490 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-[(2-cyclopenta-1,3-dien-1-yl-6-pyrazol-1-ylpyrimidin-4-yl)amino]propan-1-ol |
| SMILES | OCCCNc1cc(-n2cccn2)nc(C2=CC=CC2)n1 |
| InChI | InChI=1S/C15H17N5O/c21-10-4-7-16-13-11-14(20-9-3-8-17-20)19-15(18-13)12-5-1-2-6-12/h1-3,5,8-9,11,21H,4,6-7,10H2,(H,16,18,19) |
| InChIKey | HQXLLEONCHDWPC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|