C33H37F2O2S+ — CID 159715631
3,3-difluorobutan-2-yl adamantane-1-carboxylate;triphenylsulfanium (PubChem CID 159715631) has the molecular formula C33H37F2O2S+ and a molecular weight of 535.72 g/mol. Its IUPAC name is 3,3-difluorobutan-2-yl adamantane-1-carboxylate;triphenylsulfanium.
| Compound Name | 3,3-difluorobutan-2-yl adamantane-1-carboxylate;triphenylsulfanium |
|---|---|
| PubChem CID | 159715631 |
| Molecular Formula | C33H37F2O2S+ |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 3,3-difluorobutan-2-yl adamantane-1-carboxylate;triphenylsulfanium |
| SMILES | CC(OC(=O)C12CC3CC(CC(C3)C1)C2)C(C)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C15H22F2O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(14(2,16)17)19-13(18)15-6-10-3-11(7-15)5-12(4-10)8-15/h1-15H;9-12H,3-8H2,1-2H3/q+1; |
| InChIKey | MZJTZBDXXGRQGU-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|