About 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine
6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine (PubChem CID 159717340) has the molecular formula C23H16Br2N2
and a molecular weight of 480.20 g/mol. Its IUPAC name is 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine.
Molecular Properties
| Compound Name | 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine |
| PubChem CID | 159717340 |
| Molecular Formula | C23H16Br2N2 |
| Molecular Weight | 480.20 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine |
| SMILES | Brc1cc2cccnc2c2ccccc12.Nc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C13H8BrN.C10H8BrN/c14-12-8-9-4-3-7-15-13(9)11-6-2-1-5-10(11)12;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-8H;1-6H,12H2 |
| InChIKey | MZPFUUVUYOGWHT-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.20 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine?
The IUPAC name of 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine (CID 159717340) is 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine.
What is the SMILES notation for 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine?
The canonical SMILES for 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine is Brc1cc2cccnc2c2ccccc12.Nc1ccc(Br)c2ccccc12.
What is the InChIKey of 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine?
The InChIKey is MZPFUUVUYOGWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN.C10H8BrN/c14-12-8-9-4-3-7-15-13(9)11-6-2-1-5-10(11)12;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-8H;1-6H,12H2.
What are the key properties of 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine?
6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine has a molecular weight of 480.20 g/mol, XLogP of 7.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromobenzo[h]quinoline;4-bromonaphthalen-1-amine is sourced from PubChem (CID 159717340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).