C15H25N3O4S — CID 159725111
N,N-bis(methylamino)-2-methylidenepentanamide;methyl benzenesulfonate (PubChem CID 159725111) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is N,N-bis(methylamino)-2-methylidenepentanamide;methyl benzenesulfonate.
| Compound Name | N,N-bis(methylamino)-2-methylidenepentanamide;methyl benzenesulfonate |
|---|---|
| PubChem CID | 159725111 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N,N-bis(methylamino)-2-methylidenepentanamide;methyl benzenesulfonate |
| SMILES | C=C(CCC)C(=O)N(NC)NC.COS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C8H17N3O.C7H8O3S/c1-5-6-7(2)8(12)11(9-3)10-4;1-10-11(8,9)7-5-3-2-4-6-7/h9-10H,2,5-6H2,1,3-4H3;2-6H,1H3 |
| InChIKey | NANMXDPZDUTYIN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|