C46H38N2O2S2 — CID 159730497
(E)-2-cyano-3-[2-[6-[(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-(9,9-dimethylfluoren-2-yl)amino]-1-benzothiophen-2-yl]-2,3-dihydrothiophen-5-yl]prop-2-enoic acid (PubChem CID 159730497) has the molecular formula C46H38N2O2S2 and a molecular weight of 714.96 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-[6-[(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-(9,9-dimethylfluoren-2-yl)amino]-1-benzothiophen-2-yl]-2,3-dihydrothiophen-5-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[2-[6-[(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-(9,9-dimethylfluoren-2-yl)amino]-1-benzothiophen-2-yl]-2,3-dihydrothiophen-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 159730497 |
| Molecular Formula | C46H38N2O2S2 |
| Molecular Weight | 714.96 g/mol |
| Exact Mass | 714.24 |
| IUPAC Name | (E)-2-cyano-3-[2-[6-[(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-(9,9-dimethylfluoren-2-yl)amino]-1-benzothiophen-2-yl]-2,3-dihydrothiophen-5-yl]prop-2-enoic acid |
| SMILES | CC1(C)C2=C(CCC=C2)c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4cc(C5CC=C(/C=C(\C#N)C(=O)O)S5)sc4c3)cc21 |
| InChI | InChI=1S/C46H38N2O2S2/c1-45(2)37-11-7-5-9-33(37)35-18-15-29(23-39(35)45)48(30-16-19-36-34-10-6-8-12-38(34)46(3,4)40(36)24-30)31-14-13-27-22-43(52-42(27)25-31)41-20-17-32(51-41)21-28(26-47)44(49)50/h5,7-9,11-19,21-25,41H,6,10,20H2,1-4H3,(H,49,50)/b28-21+ |
| InChIKey | NBEGQTHTSYMSDE-SGWCAAJKSA-N |
| XLogP | 12.67 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.96 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|