C11H17P — CID 159739826
(2-cyclohexylcyclopenta-1,3-dien-1-yl)phosphane (PubChem CID 159739826) has the molecular formula C11H17P and a molecular weight of 180.23 g/mol. Its IUPAC name is (2-cyclohexylcyclopenta-1,3-dien-1-yl)phosphane.
| Compound Name | (2-cyclohexylcyclopenta-1,3-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 159739826 |
| Molecular Formula | C11H17P |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | (2-cyclohexylcyclopenta-1,3-dien-1-yl)phosphane |
| SMILES | PC1=C(C2CCCCC2)C=CC1 |
| InChI | InChI=1S/C11H17P/c12-11-8-4-7-10(11)9-5-2-1-3-6-9/h4,7,9H,1-3,5-6,8,12H2 |
| InChIKey | ZEPQPDDUQSSKSJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|