C17H27P — CID 87669134
(2,3-dicyclohexylcyclopenta-2,4-dien-1-yl)phosphane (PubChem CID 87669134) has the molecular formula C17H27P and a molecular weight of 262.38 g/mol. Its IUPAC name is (2,3-dicyclohexylcyclopenta-2,4-dien-1-yl)phosphane.
| Compound Name | (2,3-dicyclohexylcyclopenta-2,4-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 87669134 |
| Molecular Formula | C17H27P |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (2,3-dicyclohexylcyclopenta-2,4-dien-1-yl)phosphane |
| SMILES | PC1C=CC(C2CCCCC2)=C1C1CCCCC1 |
| InChI | InChI=1S/C17H27P/c18-16-12-11-15(13-7-3-1-4-8-13)17(16)14-9-5-2-6-10-14/h11-14,16H,1-10,18H2 |
| InChIKey | SLYTYOKLHDSHDQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|