C9H13N3S — CID 24847136
5-cyclohexyl-2H-1,2,4-triazine-3-thione (PubChem CID 24847136) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 5-cyclohexyl-2H-1,2,4-triazine-3-thione.
| Compound Name | 5-cyclohexyl-2H-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 24847136 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 5-cyclohexyl-2H-1,2,4-triazine-3-thione |
| SMILES | S=c1nc(C2CCCCC2)cn[nH]1 |
| InChI | InChI=1S/C9H13N3S/c13-9-11-8(6-10-12-9)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,11,12,13) |
| InChIKey | OJJYFOMIAOYEAH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|