C19H30N2O8P- — CID 159740624
[(3aS,4R,6R)-2,2-diethyl-4-(5-methyl-2-methylidene-4-oxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl propyl phosphate (PubChem CID 159740624) has the molecular formula C19H30N2O8P- and a molecular weight of 445.43 g/mol. Its IUPAC name is [(3aS,4R,6R)-2,2-diethyl-4-(5-methyl-2-methylidene-4-oxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl propyl phosphate.
| Compound Name | [(3aS,4R,6R)-2,2-diethyl-4-(5-methyl-2-methylidene-4-oxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl propyl phosphate |
|---|---|
| PubChem CID | 159740624 |
| Molecular Formula | C19H30N2O8P- |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [(3aS,4R,6R)-2,2-diethyl-4-(5-methyl-2-methylidene-4-oxopyrimidin-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl propyl phosphate |
| SMILES | C=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](COP(=O)([O-])OCCC)C2OC(CC)(CC)O[C@@H]21 |
| InChI | InChI=1S/C19H31N2O8P/c1-6-9-25-30(23,24)26-11-14-15-16(29-19(7-2,8-3)28-15)18(27-14)21-10-12(4)17(22)20-13(21)5/h10,14-16,18H,5-9,11H2,1-4H3,(H,20,22)(H,23,24)/p-1/t14-,15?,16+,18-/m1/s1 |
| InChIKey | NCKIGXRUSBTUMF-OJISTFMOSA-M |
| XLogP | 1.73 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|