About 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine
1-aminopropan-2-one;azidomethane;O-methylhydroxylamine (PubChem CID 159740744) has the molecular formula C5H15N5O2
and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine.
Molecular Properties
| Compound Name | 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine |
| PubChem CID | 159740744 |
| Molecular Formula | C5H15N5O2 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine |
| SMILES | CC(=O)CN.CN=[N+]=[N-].CON |
| InChI | InChI=1S/C3H7NO.CH3N3.CH5NO/c1-3(5)2-4;1-3-4-2;1-3-2/h2,4H2,1H3;1H3;2H2,1H3 |
| InChIKey | NCKQIQFGCZZZGF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine?
The IUPAC name of 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine (CID 159740744) is 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine.
What is the SMILES notation for 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine?
The canonical SMILES for 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine is CC(=O)CN.CN=[N+]=[N-].CON.
What is the InChIKey of 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine?
The InChIKey is NCKQIQFGCZZZGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.CH3N3.CH5NO/c1-3(5)2-4;1-3-4-2;1-3-2/h2,4H2,1H3;1H3;2H2,1H3.
What are the key properties of 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine?
1-aminopropan-2-one;azidomethane;O-methylhydroxylamine has a molecular weight of 177.21 g/mol, XLogP of -0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-one;azidomethane;O-methylhydroxylamine is sourced from PubChem (CID 159740744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).