About 1-aminooxypropan-2-one;1-aminopropan-2-one
1-aminooxypropan-2-one;1-aminopropan-2-one (PubChem CID 158191453) has the molecular formula C6H14N2O3
and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-aminooxypropan-2-one;1-aminopropan-2-one.
Molecular Properties
| Compound Name | 1-aminooxypropan-2-one;1-aminopropan-2-one |
| PubChem CID | 158191453 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-aminooxypropan-2-one;1-aminopropan-2-one |
| SMILES | CC(=O)CN.CC(=O)CON |
| InChI | InChI=1S/C3H7NO2.C3H7NO/c1-3(5)2-6-4;1-3(5)2-4/h2,4H2,1H3;2,4H2,1H3 |
| InChIKey | FZUNZMNRDOXBKS-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminooxypropan-2-one;1-aminopropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminooxypropan-2-one;1-aminopropan-2-one?
The IUPAC name of 1-aminooxypropan-2-one;1-aminopropan-2-one (CID 158191453) is 1-aminooxypropan-2-one;1-aminopropan-2-one.
What is the SMILES notation for 1-aminooxypropan-2-one;1-aminopropan-2-one?
The canonical SMILES for 1-aminooxypropan-2-one;1-aminopropan-2-one is CC(=O)CN.CC(=O)CON.
What is the InChIKey of 1-aminooxypropan-2-one;1-aminopropan-2-one?
The InChIKey is FZUNZMNRDOXBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C3H7NO/c1-3(5)2-6-4;1-3(5)2-4/h2,4H2,1H3;2,4H2,1H3.
What are the key properties of 1-aminooxypropan-2-one;1-aminopropan-2-one?
1-aminooxypropan-2-one;1-aminopropan-2-one has a molecular weight of 162.19 g/mol, XLogP of -1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminooxypropan-2-one;1-aminopropan-2-one is sourced from PubChem (CID 158191453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).