About 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline
1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline (PubChem CID 159752223) has the molecular formula C28H40N2
and a molecular weight of 404.64 g/mol. Its IUPAC name is 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline.
Molecular Properties
| Compound Name | 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline |
| PubChem CID | 159752223 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline |
| SMILES | CC(C)c1ccc(N)cc1.CC(C)c1ccccc1N.Cc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C10H14.2C9H13N/c1-8(2)10-6-4-5-9(3)7-10;1-7(2)8-3-5-9(10)6-4-8;1-7(2)8-5-3-4-6-9(8)10/h4-8H,1-3H3;2*3-7H,10H2,1-2H3 |
| InChIKey | NDUGBNJNIPGCIA-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline?
The IUPAC name of 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline (CID 159752223) is 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline.
What is the SMILES notation for 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline?
The canonical SMILES for 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline is CC(C)c1ccc(N)cc1.CC(C)c1ccccc1N.Cc1cccc(C(C)C)c1.
What is the InChIKey of 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline?
The InChIKey is NDUGBNJNIPGCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.2C9H13N/c1-8(2)10-6-4-5-9(3)7-10;1-7(2)8-3-5-9(10)6-4-8;1-7(2)8-5-3-4-6-9(8)10/h4-8H,1-3H3;2*3-7H,10H2,1-2H3.
What are the key properties of 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline?
1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline has a molecular weight of 404.64 g/mol, XLogP of 7.90, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-propan-2-ylbenzene;2-propan-2-ylaniline;4-propan-2-ylaniline is sourced from PubChem (CID 159752223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).