C22H39NS — CID 159760529
4-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole;(1E)-5-propan-2-ylcyclooctene (PubChem CID 159760529) has the molecular formula C22H39NS and a molecular weight of 349.63 g/mol. Its IUPAC name is 4-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole;(1E)-5-propan-2-ylcyclooctene.
| Compound Name | 4-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole;(1E)-5-propan-2-ylcyclooctene |
|---|---|
| PubChem CID | 159760529 |
| Molecular Formula | C22H39NS |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 4-tert-butyl-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole;(1E)-5-propan-2-ylcyclooctene |
| SMILES | C=C1CC2C(CSC2C(C)(C)C)N1.CC(C)C1CC/C=C\CCC1 |
| InChI | InChI=1S/C11H19NS.C11H20/c1-7-5-8-9(12-7)6-13-10(8)11(2,3)4;1-10(2)11-8-6-4-3-5-7-9-11/h8-10,12H,1,5-6H2,2-4H3;3-4,10-11H,5-9H2,1-2H3/b;4-3- |
| InChIKey | NEUZHNSSQWRSCO-QGAMPUOQSA-N |
| XLogP | 6.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|