C14H25NS — CID 158691201
(3aS,6aR)-6-(5-methylhexyl)-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole (PubChem CID 158691201) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is (3aS,6aR)-6-(5-methylhexyl)-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole.
| Compound Name | (3aS,6aR)-6-(5-methylhexyl)-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole |
|---|---|
| PubChem CID | 158691201 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (3aS,6aR)-6-(5-methylhexyl)-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrole |
| SMILES | C=C1C[C@@H]2CSC(CCCCC(C)C)[C@@H]2N1 |
| InChI | InChI=1S/C14H25NS/c1-10(2)6-4-5-7-13-14-12(9-16-13)8-11(3)15-14/h10,12-15H,3-9H2,1-2H3/t12-,13?,14-/m1/s1 |
| InChIKey | DMQXQXMATWRXTQ-WYAMFQBQSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|