C15H26N2S — CID 144977799
2-methylidene-4-(6-methyl-5-methylideneheptyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 144977799) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is 2-methylidene-4-(6-methyl-5-methylideneheptyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | 2-methylidene-4-(6-methyl-5-methylideneheptyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 144977799 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2-methylidene-4-(6-methyl-5-methylideneheptyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | C=C1NC2CSC(CCCCC(=C)C(C)C)C2N1 |
| InChI | InChI=1S/C15H26N2S/c1-10(2)11(3)7-5-6-8-14-15-13(9-18-14)16-12(4)17-15/h10,13-17H,3-9H2,1-2H3 |
| InChIKey | KPJWOCJNVUKEAA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|